C11H17NO3 — CID 111447853
N-(4-hydroxy-2-methylpentyl)furan-2-carboxamide (PubChem CID 111447853) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylpentyl)furan-2-carboxamide.
| Compound Name | N-(4-hydroxy-2-methylpentyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 111447853 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | N-(4-hydroxy-2-methylpentyl)furan-2-carboxamide |
| SMILES | CC(O)CC(C)CNC(=O)c1ccco1 |
| InChI | InChI=1S/C11H17NO3/c1-8(6-9(2)13)7-12-11(14)10-4-3-5-15-10/h3-5,8-9,13H,6-7H2,1-2H3,(H,12,14) |
| InChIKey | VIMBYAVAIMZOOP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |