C9H11NO5 — CID 106108034
3-(furan-2-carbonylamino)-2-methoxypropanoic acid (PubChem CID 106108034) has the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. Its IUPAC name is 3-(furan-2-carbonylamino)-2-methoxypropanoic acid.
| Compound Name | 3-(furan-2-carbonylamino)-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 106108034 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 3-(furan-2-carbonylamino)-2-methoxypropanoic acid |
| SMILES | COC(CNC(=O)c1ccco1)C(=O)O |
| InChI | InChI=1S/C9H11NO5/c1-14-7(9(12)13)5-10-8(11)6-3-2-4-15-6/h2-4,7H,5H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | HHDSIJBMMKIEFL-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |