C8H8Cl3NO3 — CID 3090290
N-(2,2,2-trichloro-1-methoxyethyl)furan-2-carboxamide (PubChem CID 3090290) has the molecular formula C8H8Cl3NO3 and a molecular weight of 272.51 g/mol. Its IUPAC name is N-(2,2,2-trichloro-1-methoxyethyl)furan-2-carboxamide.
| Compound Name | N-(2,2,2-trichloro-1-methoxyethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3090290 |
| Molecular Formula | C8H8Cl3NO3 |
| Molecular Weight | 272.51 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | N-(2,2,2-trichloro-1-methoxyethyl)furan-2-carboxamide |
| SMILES | COC(NC(=O)c1ccco1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H8Cl3NO3/c1-14-7(8(9,10)11)12-6(13)5-3-2-4-15-5/h2-4,7H,1H3,(H,12,13) |
| InChIKey | MSOICYLWSVLNNU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|