C12H12Cl3N2O3+ — CID 7081026
furan-2-ylmethyl-[(1S)-2,2,2-trichloro-1-(furan-2-carbonylamino)ethyl]azanium (PubChem CID 7081026) has the molecular formula C12H12Cl3N2O3+ and a molecular weight of 338.60 g/mol. Its IUPAC name is furan-2-ylmethyl-[(1S)-2,2,2-trichloro-1-(furan-2-carbonylamino)ethyl]azanium.
| Compound Name | furan-2-ylmethyl-[(1S)-2,2,2-trichloro-1-(furan-2-carbonylamino)ethyl]azanium |
|---|---|
| PubChem CID | 7081026 |
| Molecular Formula | C12H12Cl3N2O3+ |
| Molecular Weight | 338.60 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | furan-2-ylmethyl-[(1S)-2,2,2-trichloro-1-(furan-2-carbonylamino)ethyl]azanium |
| SMILES | O=C(N[C@@H]([NH2+]Cc1ccco1)C(Cl)(Cl)Cl)c1ccco1 |
| InChI | InChI=1S/C12H11Cl3N2O3/c13-12(14,15)11(16-7-8-3-1-5-19-8)17-10(18)9-4-2-6-20-9/h1-6,11,16H,7H2,(H,17,18)/p+1/t11-/m1/s1 |
| InChIKey | YLCLJFMNTWTHQN-LLVKDONJSA-O |
| XLogP | 2.06 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.60 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|