C13H10Cl3FN2O2 — CID 3104209
N-[2,2,2-trichloro-1-(2-fluoroanilino)ethyl]furan-2-carboxamide (PubChem CID 3104209) has the molecular formula C13H10Cl3FN2O2 and a molecular weight of 351.59 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(2-fluoroanilino)ethyl]furan-2-carboxamide.
| Compound Name | N-[2,2,2-trichloro-1-(2-fluoroanilino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3104209 |
| Molecular Formula | C13H10Cl3FN2O2 |
| Molecular Weight | 351.59 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | N-[2,2,2-trichloro-1-(2-fluoroanilino)ethyl]furan-2-carboxamide |
| SMILES | O=C(NC(Nc1ccccc1F)C(Cl)(Cl)Cl)c1ccco1 |
| InChI | InChI=1S/C13H10Cl3FN2O2/c14-13(15,16)12(18-9-5-2-1-4-8(9)17)19-11(20)10-6-3-7-21-10/h1-7,12,18H,(H,19,20) |
| InChIKey | IRPMVTYKUUVFTF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|