C15H12Cl3FN2O — CID 1379485
N-[(1S)-2,2,2-trichloro-1-(2-fluoroanilino)ethyl]benzamide (PubChem CID 1379485) has the molecular formula C15H12Cl3FN2O and a molecular weight of 361.63 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-(2-fluoroanilino)ethyl]benzamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-(2-fluoroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 1379485 |
| Molecular Formula | C15H12Cl3FN2O |
| Molecular Weight | 361.63 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-(2-fluoroanilino)ethyl]benzamide |
| SMILES | O=C(N[C@H](Nc1ccccc1F)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C15H12Cl3FN2O/c16-15(17,18)14(20-12-9-5-4-8-11(12)19)21-13(22)10-6-2-1-3-7-10/h1-9,14,20H,(H,21,22)/t14-/m0/s1 |
| InChIKey | ULLNTFLEEKYKQT-AWEZNQCLSA-N |
| XLogP | 4.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|