C14H11Cl4N3O — CID 123488159
N-[2,2,2-trichloro-1-[(6-chloro-3-pyridinyl)amino]ethyl]benzamide (PubChem CID 123488159) has the molecular formula C14H11Cl4N3O and a molecular weight of 379.07 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[(6-chloro-3-pyridinyl)amino]ethyl]benzamide.
| Compound Name | N-[2,2,2-trichloro-1-[(6-chloro-3-pyridinyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 123488159 |
| Molecular Formula | C14H11Cl4N3O |
| Molecular Weight | 379.07 g/mol |
| Exact Mass | 376.97 |
| IUPAC Name | N-[2,2,2-trichloro-1-[(6-chloro-3-pyridinyl)amino]ethyl]benzamide |
| SMILES | O=C(NC(Nc1ccc(Cl)nc1)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C14H11Cl4N3O/c15-11-7-6-10(8-19-11)20-13(14(16,17)18)21-12(22)9-4-2-1-3-5-9/h1-8,13,20H,(H,21,22) |
| InChIKey | DGFZEDTYNNWRRT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.07 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|