C16H12Cl4F2N2OS — CID 34306906
4-chloro-N-[(1R)-2,2,2-trichloro-1-[4-(difluoromethylsulfanyl)anilino]ethyl]benzamide (PubChem CID 34306906) has the molecular formula C16H12Cl4F2N2OS and a molecular weight of 460.16 g/mol. Its IUPAC name is 4-chloro-N-[(1R)-2,2,2-trichloro-1-[4-(difluoromethylsulfanyl)anilino]ethyl]benzamide.
| Compound Name | 4-chloro-N-[(1R)-2,2,2-trichloro-1-[4-(difluoromethylsulfanyl)anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 34306906 |
| Molecular Formula | C16H12Cl4F2N2OS |
| Molecular Weight | 460.16 g/mol |
| Exact Mass | 457.94 |
| IUPAC Name | 4-chloro-N-[(1R)-2,2,2-trichloro-1-[4-(difluoromethylsulfanyl)anilino]ethyl]benzamide |
| SMILES | O=C(N[C@@H](Nc1ccc(SC(F)F)cc1)C(Cl)(Cl)Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12Cl4F2N2OS/c17-10-3-1-9(2-4-10)13(25)24-14(16(18,19)20)23-11-5-7-12(8-6-11)26-15(21)22/h1-8,14-15,23H,(H,24,25)/t14-/m1/s1 |
| InChIKey | QDHKSKHNGXBLNJ-CQSZACIVSA-N |
| XLogP | 6.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.16 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|