C15H12ClF2NOS — CID 110825305
1-(4-chlorophenyl)-2-[4-(difluoromethylsulfanyl)anilino]ethanone (PubChem CID 110825305) has the molecular formula C15H12ClF2NOS and a molecular weight of 327.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[4-(difluoromethylsulfanyl)anilino]ethanone.
| Compound Name | 1-(4-chlorophenyl)-2-[4-(difluoromethylsulfanyl)anilino]ethanone |
|---|---|
| PubChem CID | 110825305 |
| Molecular Formula | C15H12ClF2NOS |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[4-(difluoromethylsulfanyl)anilino]ethanone |
| SMILES | O=C(CNc1ccc(SC(F)F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12ClF2NOS/c16-11-3-1-10(2-4-11)14(20)9-19-12-5-7-13(8-6-12)21-15(17)18/h1-8,15,19H,9H2 |
| InChIKey | WWYGRMQOYKWWHA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |