C15H13ClF2N2OS — CID 9098703
2-(2-chloroanilino)-N-[4-(difluoromethylsulfanyl)phenyl]acetamide (PubChem CID 9098703) has the molecular formula C15H13ClF2N2OS and a molecular weight of 342.80 g/mol. Its IUPAC name is 2-(2-chloroanilino)-N-[4-(difluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-(2-chloroanilino)-N-[4-(difluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9098703 |
| Molecular Formula | C15H13ClF2N2OS |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2-(2-chloroanilino)-N-[4-(difluoromethylsulfanyl)phenyl]acetamide |
| SMILES | O=C(CNc1ccccc1Cl)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C15H13ClF2N2OS/c16-12-3-1-2-4-13(12)19-9-14(21)20-10-5-7-11(8-6-10)22-15(17)18/h1-8,15,19H,9H2,(H,20,21) |
| InChIKey | JOIBBTQMHDECQN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |