C18H20F2N2O3S — CID 9105236
N-[4-(difluoromethylsulfanyl)phenyl]-2-(4,5-dimethoxy-2-methylanilino)acetamide (PubChem CID 9105236) has the molecular formula C18H20F2N2O3S and a molecular weight of 382.43 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-2-(4,5-dimethoxy-2-methylanilino)acetamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-2-(4,5-dimethoxy-2-methylanilino)acetamide |
|---|---|
| PubChem CID | 9105236 |
| Molecular Formula | C18H20F2N2O3S |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-2-(4,5-dimethoxy-2-methylanilino)acetamide |
| SMILES | COc1cc(C)c(NCC(=O)Nc2ccc(SC(F)F)cc2)cc1OC |
| InChI | InChI=1S/C18H20F2N2O3S/c1-11-8-15(24-2)16(25-3)9-14(11)21-10-17(23)22-12-4-6-13(7-5-12)26-18(19)20/h4-9,18,21H,10H2,1-3H3,(H,22,23) |
| InChIKey | FMRRODNBQGBEGX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|