C18H19F3N2O3 — CID 9105343
2-(4,5-dimethoxy-2-methylanilino)-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 9105343) has the molecular formula C18H19F3N2O3 and a molecular weight of 368.36 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-methylanilino)-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(4,5-dimethoxy-2-methylanilino)-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9105343 |
| Molecular Formula | C18H19F3N2O3 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-(4,5-dimethoxy-2-methylanilino)-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1cc(C)c(NCC(=O)Nc2ccc(C(F)(F)F)cc2)cc1OC |
| InChI | InChI=1S/C18H19F3N2O3/c1-11-8-15(25-2)16(26-3)9-14(11)22-10-17(24)23-13-6-4-12(5-7-13)18(19,20)21/h4-9,22H,10H2,1-3H3,(H,23,24) |
| InChIKey | GWOGBSFUCHDKIX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|