C17H15F3N2O3 — CID 36586938
methyl 3-[[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]amino]benzoate (PubChem CID 36586938) has the molecular formula C17H15F3N2O3 and a molecular weight of 352.31 g/mol. Its IUPAC name is methyl 3-[[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]amino]benzoate.
| Compound Name | methyl 3-[[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]amino]benzoate |
|---|---|
| PubChem CID | 36586938 |
| Molecular Formula | C17H15F3N2O3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | methyl 3-[[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NCC(=O)Nc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H15F3N2O3/c1-25-16(24)11-3-2-4-14(9-11)21-10-15(23)22-13-7-5-12(6-8-13)17(18,19)20/h2-9,21H,10H2,1H3,(H,22,23) |
| InChIKey | COMIDCGYEYERFM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |