C16H15BrN2O3 — CID 603629
methyl 4-[[2-(3-bromoanilino)acetyl]amino]benzoate (PubChem CID 603629) has the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. Its IUPAC name is methyl 4-[[2-(3-bromoanilino)acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(3-bromoanilino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 603629 |
| Molecular Formula | C16H15BrN2O3 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | methyl 4-[[2-(3-bromoanilino)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CNc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C16H15BrN2O3/c1-22-16(21)11-5-7-13(8-6-11)19-15(20)10-18-14-4-2-3-12(17)9-14/h2-9,18H,10H2,1H3,(H,19,20) |
| InChIKey | LLPGUDGZYPMNTA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |