C13H17F2NOS — CID 112759140
N-[4-(difluoromethylsulfanyl)phenyl]-3,3-dimethylbutanamide (PubChem CID 112759140) has the molecular formula C13H17F2NOS and a molecular weight of 273.35 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 112759140 |
| Molecular Formula | C13H17F2NOS |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C13H17F2NOS/c1-13(2,3)8-11(17)16-9-4-6-10(7-5-9)18-12(14)15/h4-7,12H,8H2,1-3H3,(H,16,17) |
| InChIKey | WDQLEGOMMHYTHV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |