C16H24N2O2 — CID 26907229
3,3-dimethyl-N-[4-(2-methylpropanoylamino)phenyl]butanamide (PubChem CID 26907229) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3,3-dimethyl-N-[4-(2-methylpropanoylamino)phenyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[4-(2-methylpropanoylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 26907229 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 3,3-dimethyl-N-[4-(2-methylpropanoylamino)phenyl]butanamide |
| SMILES | CC(C)C(=O)Nc1ccc(NC(=O)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H24N2O2/c1-11(2)15(20)18-13-8-6-12(7-9-13)17-14(19)10-16(3,4)5/h6-9,11H,10H2,1-5H3,(H,17,19)(H,18,20) |
| InChIKey | OFFCKVVCOQMGLT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |