C12H14ClF2NOS — CID 43440240
5-chloro-N-[4-(difluoromethylsulfanyl)phenyl]pentanamide (PubChem CID 43440240) has the molecular formula C12H14ClF2NOS and a molecular weight of 293.77 g/mol. Its IUPAC name is 5-chloro-N-[4-(difluoromethylsulfanyl)phenyl]pentanamide.
| Compound Name | 5-chloro-N-[4-(difluoromethylsulfanyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 43440240 |
| Molecular Formula | C12H14ClF2NOS |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 5-chloro-N-[4-(difluoromethylsulfanyl)phenyl]pentanamide |
| SMILES | O=C(CCCCCl)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C12H14ClF2NOS/c13-8-2-1-3-11(17)16-9-4-6-10(7-5-9)18-12(14)15/h4-7,12H,1-3,8H2,(H,16,17) |
| InChIKey | PNSRPVJYZHAXEG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|