C10H11ClF2N2OS — CID 2327059
1-(2-chloroethyl)-3-[4-(difluoromethylsulfanyl)phenyl]urea (PubChem CID 2327059) has the molecular formula C10H11ClF2N2OS and a molecular weight of 280.73 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[4-(difluoromethylsulfanyl)phenyl]urea.
| Compound Name | 1-(2-chloroethyl)-3-[4-(difluoromethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 2327059 |
| Molecular Formula | C10H11ClF2N2OS |
| Molecular Weight | 280.73 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 1-(2-chloroethyl)-3-[4-(difluoromethylsulfanyl)phenyl]urea |
| SMILES | O=C(NCCCl)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C10H11ClF2N2OS/c11-5-6-14-10(16)15-7-1-3-8(4-2-7)17-9(12)13/h1-4,9H,5-6H2,(H2,14,15,16) |
| InChIKey | GCMUDPHPNRGNEE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|