C15H21F2N3O2S — CID 18083018
2-[[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl]-methylamino]-N-propylacetamide (PubChem CID 18083018) has the molecular formula C15H21F2N3O2S and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-[[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl]-methylamino]-N-propylacetamide.
| Compound Name | 2-[[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl]-methylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 18083018 |
| Molecular Formula | C15H21F2N3O2S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-[[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl]-methylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C)CC(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C15H21F2N3O2S/c1-3-8-18-13(21)9-20(2)10-14(22)19-11-4-6-12(7-5-11)23-15(16)17/h4-7,15H,3,8-10H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | ZDYDQYNNNZZHRR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |