C17H17BrF2N2OS — CID 2698696
2-[(4-bromophenyl)methyl-methylamino]-N-[4-(difluoromethylsulfanyl)phenyl]acetamide (PubChem CID 2698696) has the molecular formula C17H17BrF2N2OS and a molecular weight of 415.30 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-methylamino]-N-[4-(difluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-[(4-bromophenyl)methyl-methylamino]-N-[4-(difluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 2698696 |
| Molecular Formula | C17H17BrF2N2OS |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-methylamino]-N-[4-(difluoromethylsulfanyl)phenyl]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(SC(F)F)cc1)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H17BrF2N2OS/c1-22(10-12-2-4-13(18)5-3-12)11-16(23)21-14-6-8-15(9-7-14)24-17(19)20/h2-9,17H,10-11H2,1H3,(H,21,23) |
| InChIKey | MBQJOWXJAUEYPI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |