C19H22F2N2O2S — CID 18094879
N-[4-(difluoromethylsulfanyl)phenyl]-2-[methyl-[2-(4-methylphenoxy)ethyl]amino]acetamide (PubChem CID 18094879) has the molecular formula C19H22F2N2O2S and a molecular weight of 380.46 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-2-[methyl-[2-(4-methylphenoxy)ethyl]amino]acetamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-2-[methyl-[2-(4-methylphenoxy)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 18094879 |
| Molecular Formula | C19H22F2N2O2S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-2-[methyl-[2-(4-methylphenoxy)ethyl]amino]acetamide |
| SMILES | Cc1ccc(OCCN(C)CC(=O)Nc2ccc(SC(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H22F2N2O2S/c1-14-3-7-16(8-4-14)25-12-11-23(2)13-18(24)22-15-5-9-17(10-6-15)26-19(20)21/h3-10,19H,11-13H2,1-2H3,(H,22,24) |
| InChIKey | IGWZTJVYBBJDFH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |