C14H19F2N3O2S2 — CID 8560795
2-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl-methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 8560795) has the molecular formula C14H19F2N3O2S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl-methylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl-methylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 8560795 |
| Molecular Formula | C14H19F2N3O2S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl-methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C)C(=S)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C14H19F2N3O2S2/c1-19(9-12(20)17-7-8-21-2)14(22)18-10-3-5-11(6-4-10)23-13(15)16/h3-6,13H,7-9H2,1-2H3,(H,17,20)(H,18,22) |
| InChIKey | CMHOHGSLUSZCJF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|