C16H21F2N2O3S+ — CID 2442356
methyl 1-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl]piperidin-1-ium-4-carboxylate (PubChem CID 2442356) has the molecular formula C16H21F2N2O3S+ and a molecular weight of 359.42 g/mol. Its IUPAC name is methyl 1-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | methyl 1-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 2442356 |
| Molecular Formula | C16H21F2N2O3S+ |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | methyl 1-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl]piperidin-1-ium-4-carboxylate |
| SMILES | COC(=O)C1CC[NH+](CC(=O)Nc2ccc(SC(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H20F2N2O3S/c1-23-15(22)11-6-8-20(9-7-11)10-14(21)19-12-2-4-13(5-3-12)24-16(17)18/h2-5,11,16H,6-10H2,1H3,(H,19,21)/p+1 |
| InChIKey | WZFMZDMUUVXZLZ-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |