C18H27F2N4OS2+ — CID 9213695
N-tert-butyl-2-[4-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 9213695) has the molecular formula C18H27F2N4OS2+ and a molecular weight of 417.57 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9213695 |
| Molecular Formula | C18H27F2N4OS2+ |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N-tert-butyl-2-[4-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | CC(C)(C)NC(=O)C[NH+]1CCN(C(=S)Nc2ccc(SC(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H26F2N4OS2/c1-18(2,3)22-15(25)12-23-8-10-24(11-9-23)17(26)21-13-4-6-14(7-5-13)27-16(19)20/h4-7,16H,8-12H2,1-3H3,(H,21,26)(H,22,25)/p+1 |
| InChIKey | HXMGBLKFSPZBPY-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|