C20H20F3N3OS2 — CID 43076626
N-[1-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl]piperidin-4-yl]-2-fluorobenzamide (PubChem CID 43076626) has the molecular formula C20H20F3N3OS2 and a molecular weight of 439.53 g/mol. Its IUPAC name is N-[1-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl]piperidin-4-yl]-2-fluorobenzamide.
| Compound Name | N-[1-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl]piperidin-4-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 43076626 |
| Molecular Formula | C20H20F3N3OS2 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | N-[1-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl]piperidin-4-yl]-2-fluorobenzamide |
| SMILES | O=C(NC1CCN(C(=S)Nc2ccc(SC(F)F)cc2)CC1)c1ccccc1F |
| InChI | InChI=1S/C20H20F3N3OS2/c21-17-4-2-1-3-16(17)18(27)24-14-9-11-26(12-10-14)20(28)25-13-5-7-15(8-6-13)29-19(22)23/h1-8,14,19H,9-12H2,(H,24,27)(H,25,28) |
| InChIKey | NYHSWNIBCFKXBW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|