C12H14F2N2OS2 — CID 8620460
N-[4-(difluoromethylsulfanyl)phenyl]morpholine-4-carbothioamide (PubChem CID 8620460) has the molecular formula C12H14F2N2OS2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]morpholine-4-carbothioamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 8620460 |
| Molecular Formula | C12H14F2N2OS2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]morpholine-4-carbothioamide |
| SMILES | FC(F)Sc1ccc(NC(=S)N2CCOCC2)cc1 |
| InChI | InChI=1S/C12H14F2N2OS2/c13-11(14)19-10-3-1-9(2-4-10)15-12(18)16-5-7-17-8-6-16/h1-4,11H,5-8H2,(H,15,18) |
| InChIKey | DYUAGVXCPAGOEO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|