C19H17F2N3OS2 — CID 166188710
2-(3-cyanophenyl)-N-[4-(difluoromethylsulfanyl)phenyl]morpholine-4-carbothioamide (PubChem CID 166188710) has the molecular formula C19H17F2N3OS2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-(3-cyanophenyl)-N-[4-(difluoromethylsulfanyl)phenyl]morpholine-4-carbothioamide.
| Compound Name | 2-(3-cyanophenyl)-N-[4-(difluoromethylsulfanyl)phenyl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 166188710 |
| Molecular Formula | C19H17F2N3OS2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 2-(3-cyanophenyl)-N-[4-(difluoromethylsulfanyl)phenyl]morpholine-4-carbothioamide |
| SMILES | N#Cc1cccc(C2CN(C(=S)Nc3ccc(SC(F)F)cc3)CCO2)c1 |
| InChI | InChI=1S/C19H17F2N3OS2/c20-18(21)27-16-6-4-15(5-7-16)23-19(26)24-8-9-25-17(12-24)14-3-1-2-13(10-14)11-22/h1-7,10,17-18H,8-9,12H2,(H,23,26) |
| InChIKey | JVZLDOFXFJEXLP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|