About 3-[(2S)-4-[2-(1,3-dioxolan-2-yl)ethyl]morpholin-2-yl]benzonitrile
3-[(2S)-4-[2-(1,3-dioxolan-2-yl)ethyl]morpholin-2-yl]benzonitrile (PubChem CID 124888664) has the molecular formula C16H20N2O3
and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-[(2S)-4-[2-(1,3-dioxolan-2-yl)ethyl]morpholin-2-yl]benzonitrile.
Molecular Properties
| Compound Name | 3-[(2S)-4-[2-(1,3-dioxolan-2-yl)ethyl]morpholin-2-yl]benzonitrile |
| PubChem CID | 124888664 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3-[(2S)-4-[2-(1,3-dioxolan-2-yl)ethyl]morpholin-2-yl]benzonitrile |
| SMILES | N#Cc1cccc([C@H]2CN(CCC3OCCO3)CCO2)c1 |
| InChI | InChI=1S/C16H20N2O3/c17-11-13-2-1-3-14(10-13)15-12-18(6-7-19-15)5-4-16-20-8-9-21-16/h1-3,10,15-16H,4-9,12H2/t15-/m1/s1 |
| InChIKey | LRMBOCWCOZJDHF-OAHLLOKOSA-N |
| XLogP | 1.69 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2S)-4-[2-(1,3-dioxolan-2-yl)ethyl]morpholin-2-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-4-[2-(1,3-dioxolan-2-yl)ethyl]morpholin-2-yl]benzonitrile?
The IUPAC name of 3-[(2S)-4-[2-(1,3-dioxolan-2-yl)ethyl]morpholin-2-yl]benzonitrile (CID 124888664) is 3-[(2S)-4-[2-(1,3-dioxolan-2-yl)ethyl]morpholin-2-yl]benzonitrile.
What is the SMILES notation for 3-[(2S)-4-[2-(1,3-dioxolan-2-yl)ethyl]morpholin-2-yl]benzonitrile?
The canonical SMILES for 3-[(2S)-4-[2-(1,3-dioxolan-2-yl)ethyl]morpholin-2-yl]benzonitrile is N#Cc1cccc([C@H]2CN(CCC3OCCO3)CCO2)c1.
What is the InChIKey of 3-[(2S)-4-[2-(1,3-dioxolan-2-yl)ethyl]morpholin-2-yl]benzonitrile?
The InChIKey is LRMBOCWCOZJDHF-OAHLLOKOSA-N. The full InChI is InChI=1S/C16H20N2O3/c17-11-13-2-1-3-14(10-13)15-12-18(6-7-19-15)5-4-16-20-8-9-21-16/h1-3,10,15-16H,4-9,12H2/t15-/m1/s1.
What are the key properties of 3-[(2S)-4-[2-(1,3-dioxolan-2-yl)ethyl]morpholin-2-yl]benzonitrile?
3-[(2S)-4-[2-(1,3-dioxolan-2-yl)ethyl]morpholin-2-yl]benzonitrile has a molecular weight of 288.35 g/mol, XLogP of 1.69, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-4-[2-(1,3-dioxolan-2-yl)ethyl]morpholin-2-yl]benzonitrile is sourced from PubChem (CID 124888664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).