C18H20N4O3 — CID 124741580
3-[(2S)-4-[1-(2-methoxyethyl)pyrazole-3-carbonyl]morpholin-2-yl]benzonitrile (PubChem CID 124741580) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-[(2S)-4-[1-(2-methoxyethyl)pyrazole-3-carbonyl]morpholin-2-yl]benzonitrile.
| Compound Name | 3-[(2S)-4-[1-(2-methoxyethyl)pyrazole-3-carbonyl]morpholin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 124741580 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-[(2S)-4-[1-(2-methoxyethyl)pyrazole-3-carbonyl]morpholin-2-yl]benzonitrile |
| SMILES | COCCn1ccc(C(=O)N2CCO[C@@H](c3cccc(C#N)c3)C2)n1 |
| InChI | InChI=1S/C18H20N4O3/c1-24-9-8-22-6-5-16(20-22)18(23)21-7-10-25-17(13-21)15-4-2-3-14(11-15)12-19/h2-6,11,17H,7-10,13H2,1H3/t17-/m1/s1 |
| InChIKey | WRYSFWPNVVIPKQ-QGZVFWFLSA-N |
| XLogP | 1.61 |
| TPSA | 80.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |