C20H20N2O3 — CID 124883023
3-[(2R)-4-[3-(4-hydroxyphenyl)propanoyl]morpholin-2-yl]benzonitrile (PubChem CID 124883023) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-[(2R)-4-[3-(4-hydroxyphenyl)propanoyl]morpholin-2-yl]benzonitrile.
| Compound Name | 3-[(2R)-4-[3-(4-hydroxyphenyl)propanoyl]morpholin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 124883023 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 3-[(2R)-4-[3-(4-hydroxyphenyl)propanoyl]morpholin-2-yl]benzonitrile |
| SMILES | N#Cc1cccc([C@@H]2CN(C(=O)CCc3ccc(O)cc3)CCO2)c1 |
| InChI | InChI=1S/C20H20N2O3/c21-13-16-2-1-3-17(12-16)19-14-22(10-11-25-19)20(24)9-6-15-4-7-18(23)8-5-15/h1-5,7-8,12,19,23H,6,9-11,14H2/t19-/m0/s1 |
| InChIKey | QDUHUPHDTRUHGL-IBGZPJMESA-N |
| XLogP | 2.80 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |