C18H18Cl2N2O2 — CID 95180794
1-[(2R)-2-(3,4-dichlorophenyl)morpholin-4-yl]-3-pyridin-4-ylpropan-1-one (PubChem CID 95180794) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 1-[(2R)-2-(3,4-dichlorophenyl)morpholin-4-yl]-3-pyridin-4-ylpropan-1-one.
| Compound Name | 1-[(2R)-2-(3,4-dichlorophenyl)morpholin-4-yl]-3-pyridin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 95180794 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-[(2R)-2-(3,4-dichlorophenyl)morpholin-4-yl]-3-pyridin-4-ylpropan-1-one |
| SMILES | O=C(CCc1ccncc1)N1CCO[C@H](c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c19-15-3-2-14(11-16(15)20)17-12-22(9-10-24-17)18(23)4-1-13-5-7-21-8-6-13/h2-3,5-8,11,17H,1,4,9-10,12H2/t17-/m0/s1 |
| InChIKey | LGBLDEPSAHMEHB-KRWDZBQOSA-N |
| XLogP | 3.92 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |