C15H13Cl2NO3 — CID 110364303
[2-(3,4-dichlorophenyl)morpholin-4-yl]-(furan-2-yl)methanone (PubChem CID 110364303) has the molecular formula C15H13Cl2NO3 and a molecular weight of 326.18 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)morpholin-4-yl]-(furan-2-yl)methanone.
| Compound Name | [2-(3,4-dichlorophenyl)morpholin-4-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 110364303 |
| Molecular Formula | C15H13Cl2NO3 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | [2-(3,4-dichlorophenyl)morpholin-4-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCOC(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H13Cl2NO3/c16-11-4-3-10(8-12(11)17)14-9-18(5-7-21-14)15(19)13-2-1-6-20-13/h1-4,6,8,14H,5,7,9H2 |
| InChIKey | SSMXUVSZQOYVAV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |