C14H18Cl2N2O2 — CID 110364326
2-(3,4-dichlorophenyl)-N-propylmorpholine-4-carboxamide (PubChem CID 110364326) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-propylmorpholine-4-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-propylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 110364326 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-propylmorpholine-4-carboxamide |
| SMILES | CCCNC(=O)N1CCOC(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-2-5-17-14(19)18-6-7-20-13(9-18)10-3-4-11(15)12(16)8-10/h3-4,8,13H,2,5-7,9H2,1H3,(H,17,19) |
| InChIKey | VZBKPAWISBSSFD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |