C15H18Cl2N2O4 — CID 122021290
4-[[2-(3,4-dichlorophenyl)morpholine-4-carbonyl]amino]butanoic acid (PubChem CID 122021290) has the molecular formula C15H18Cl2N2O4 and a molecular weight of 361.23 g/mol. Its IUPAC name is 4-[[2-(3,4-dichlorophenyl)morpholine-4-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[2-(3,4-dichlorophenyl)morpholine-4-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122021290 |
| Molecular Formula | C15H18Cl2N2O4 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 4-[[2-(3,4-dichlorophenyl)morpholine-4-carbonyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)N1CCOC(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H18Cl2N2O4/c16-11-4-3-10(8-12(11)17)13-9-19(6-7-23-13)15(22)18-5-1-2-14(20)21/h3-4,8,13H,1-2,5-7,9H2,(H,18,22)(H,20,21) |
| InChIKey | BIKIWYMNESVQBM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|