5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid

C15H19Cl2NO3 — CID 91660392

IUPAC5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid
SMILESO=C(O)CCCCN1CCOC(c2ccc(Cl)c(Cl)c2)C1
InChIInChI=1S/C15H19Cl2NO3/c16-12-5-4-11(9-13(12)17)14-10-18(7-8-21-14)6-2-1-3-15(19)20/h4-5,9,14H,1-3,6-8,10H2,(H,19,20)
InChIKeyPCQBPESYGIEBNB-UHFFFAOYSA-N
MW332.23 g/mol
LogP3.62
Rot. Bonds6

About 5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid

5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid (PubChem CID 91660392) has the molecular formula C15H19Cl2NO3 and a molecular weight of 332.23 g/mol. Its IUPAC name is 5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid.

Molecular Properties

Compound Name5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid
PubChem CID91660392
Molecular FormulaC15H19Cl2NO3
Molecular Weight332.23 g/mol
Exact Mass331.07
IUPAC Name5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid
SMILESO=C(O)CCCCN1CCOC(c2ccc(Cl)c(Cl)c2)C1
InChIInChI=1S/C15H19Cl2NO3/c16-12-5-4-11(9-13(12)17)14-10-18(7-8-21-14)6-2-1-3-15(19)20/h4-5,9,14H,1-3,6-8,10H2,(H,19,20)
InChIKeyPCQBPESYGIEBNB-UHFFFAOYSA-N
XLogP3.62
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.23
LogP ≤ 53.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid?
The IUPAC name of 5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid (CID 91660392) is 5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid.
What is the SMILES notation for 5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid?
The canonical SMILES for 5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid is O=C(O)CCCCN1CCOC(c2ccc(Cl)c(Cl)c2)C1.
What is the InChIKey of 5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid?
The InChIKey is PCQBPESYGIEBNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2NO3/c16-12-5-4-11(9-13(12)17)14-10-18(7-8-21-14)6-2-1-3-15(19)20/h4-5,9,14H,1-3,6-8,10H2,(H,19,20).
What are the key properties of 5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid?
5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid has a molecular weight of 332.23 g/mol, XLogP of 3.62, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(3,4-dichlorophenyl)morpholin-4-yl]pentanoic acid is sourced from PubChem (CID 91660392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).