C14H17Cl2NO3 — CID 95563875
4-[(2R)-2-(3,4-dichlorophenyl)morpholin-4-yl]butanoic acid (PubChem CID 95563875) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is 4-[(2R)-2-(3,4-dichlorophenyl)morpholin-4-yl]butanoic acid.
| Compound Name | 4-[(2R)-2-(3,4-dichlorophenyl)morpholin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 95563875 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 4-[(2R)-2-(3,4-dichlorophenyl)morpholin-4-yl]butanoic acid |
| SMILES | O=C(O)CCCN1CCO[C@H](c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H17Cl2NO3/c15-11-4-3-10(8-12(11)16)13-9-17(6-7-20-13)5-1-2-14(18)19/h3-4,8,13H,1-2,5-7,9H2,(H,18,19)/t13-/m0/s1 |
| InChIKey | VDYYGCIOYOMVKF-ZDUSSCGKSA-N |
| XLogP | 3.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |