C14H18FNO3 — CID 124606773
4-[(2S)-2-(3-fluorophenyl)morpholin-4-yl]butanoic acid (PubChem CID 124606773) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is 4-[(2S)-2-(3-fluorophenyl)morpholin-4-yl]butanoic acid.
| Compound Name | 4-[(2S)-2-(3-fluorophenyl)morpholin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 124606773 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-[(2S)-2-(3-fluorophenyl)morpholin-4-yl]butanoic acid |
| SMILES | O=C(O)CCCN1CCO[C@@H](c2cccc(F)c2)C1 |
| InChI | InChI=1S/C14H18FNO3/c15-12-4-1-3-11(9-12)13-10-16(7-8-19-13)6-2-5-14(17)18/h1,3-4,9,13H,2,5-8,10H2,(H,17,18)/t13-/m1/s1 |
| InChIKey | YWASYUSBDRKBSY-CYBMUJFWSA-N |
| XLogP | 2.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |