C18H19F2NO2 — CID 110928538
1-(4-fluorophenyl)-2-[2-(3-fluorophenyl)morpholin-4-yl]ethanol (PubChem CID 110928538) has the molecular formula C18H19F2NO2 and a molecular weight of 319.35 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[2-(3-fluorophenyl)morpholin-4-yl]ethanol.
| Compound Name | 1-(4-fluorophenyl)-2-[2-(3-fluorophenyl)morpholin-4-yl]ethanol |
|---|---|
| PubChem CID | 110928538 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[2-(3-fluorophenyl)morpholin-4-yl]ethanol |
| SMILES | OC(CN1CCOC(c2cccc(F)c2)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H19F2NO2/c19-15-6-4-13(5-7-15)17(22)11-21-8-9-23-18(12-21)14-2-1-3-16(20)10-14/h1-7,10,17-18,22H,8-9,11-12H2 |
| InChIKey | LRCFFYCEYOKVGE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |