C22H29ClFNO3 — CID 138959001
1-[2-(3-fluorophenyl)morpholin-4-yl]-3-(1-phenylpropoxy)propan-2-ol;hydrochloride (PubChem CID 138959001) has the molecular formula C22H29ClFNO3 and a molecular weight of 409.93 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)morpholin-4-yl]-3-(1-phenylpropoxy)propan-2-ol;hydrochloride.
| Compound Name | 1-[2-(3-fluorophenyl)morpholin-4-yl]-3-(1-phenylpropoxy)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138959001 |
| Molecular Formula | C22H29ClFNO3 |
| Molecular Weight | 409.93 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 1-[2-(3-fluorophenyl)morpholin-4-yl]-3-(1-phenylpropoxy)propan-2-ol;hydrochloride |
| SMILES | CCC(OCC(O)CN1CCOC(c2cccc(F)c2)C1)c1ccccc1.Cl |
| InChI | InChI=1S/C22H28FNO3.ClH/c1-2-21(17-7-4-3-5-8-17)27-16-20(25)14-24-11-12-26-22(15-24)18-9-6-10-19(23)13-18;/h3-10,13,20-22,25H,2,11-12,14-16H2,1H3;1H |
| InChIKey | RPLHFRUWMATJLE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.93 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |