C26H28FNO3 — CID 138958979
1-benzhydryloxy-3-[2-(3-fluorophenyl)morpholin-4-yl]propan-2-ol (PubChem CID 138958979) has the molecular formula C26H28FNO3 and a molecular weight of 421.51 g/mol. Its IUPAC name is 1-benzhydryloxy-3-[2-(3-fluorophenyl)morpholin-4-yl]propan-2-ol.
| Compound Name | 1-benzhydryloxy-3-[2-(3-fluorophenyl)morpholin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 138958979 |
| Molecular Formula | C26H28FNO3 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 1-benzhydryloxy-3-[2-(3-fluorophenyl)morpholin-4-yl]propan-2-ol |
| SMILES | OC(COC(c1ccccc1)c1ccccc1)CN1CCOC(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C26H28FNO3/c27-23-13-7-12-22(16-23)25-18-28(14-15-30-25)17-24(29)19-31-26(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-13,16,24-26,29H,14-15,17-19H2 |
| InChIKey | DWRVFTNTRVQWRV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |