C14H22FNOSi — CID 86902020
[2-(3-fluorophenyl)morpholin-4-yl]methyl-trimethylsilane (PubChem CID 86902020) has the molecular formula C14H22FNOSi and a molecular weight of 267.42 g/mol. Its IUPAC name is [2-(3-fluorophenyl)morpholin-4-yl]methyl-trimethylsilane.
| Compound Name | [2-(3-fluorophenyl)morpholin-4-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 86902020 |
| Molecular Formula | C14H22FNOSi |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | [2-(3-fluorophenyl)morpholin-4-yl]methyl-trimethylsilane |
| SMILES | C[Si](C)(C)CN1CCOC(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C14H22FNOSi/c1-18(2,3)11-16-7-8-17-14(10-16)12-5-4-6-13(15)9-12/h4-6,9,14H,7-8,10-11H2,1-3H3 |
| InChIKey | JAXQOABIZJIBLB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|