C18H20FNO3 — CID 124614792
4-[[(2R)-2-(3-fluorophenyl)morpholin-4-yl]methyl]-2-methoxyphenol (PubChem CID 124614792) has the molecular formula C18H20FNO3 and a molecular weight of 317.36 g/mol. Its IUPAC name is 4-[[(2R)-2-(3-fluorophenyl)morpholin-4-yl]methyl]-2-methoxyphenol.
| Compound Name | 4-[[(2R)-2-(3-fluorophenyl)morpholin-4-yl]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 124614792 |
| Molecular Formula | C18H20FNO3 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-[[(2R)-2-(3-fluorophenyl)morpholin-4-yl]methyl]-2-methoxyphenol |
| SMILES | COc1cc(CN2CCO[C@H](c3cccc(F)c3)C2)ccc1O |
| InChI | InChI=1S/C18H20FNO3/c1-22-17-9-13(5-6-16(17)21)11-20-7-8-23-18(12-20)14-3-2-4-15(19)10-14/h2-6,9-10,18,21H,7-8,11-12H2,1H3/t18-/m0/s1 |
| InChIKey | ZHTSURKPPVEPAU-SFHVURJKSA-N |
| XLogP | 3.11 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |