C19H21Cl2NO4 — CID 95553357
4-[[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]methyl]-2,6-dimethoxyphenol (PubChem CID 95553357) has the molecular formula C19H21Cl2NO4 and a molecular weight of 398.29 g/mol. Its IUPAC name is 4-[[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 95553357 |
| Molecular Formula | C19H21Cl2NO4 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 4-[[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(CN2CCO[C@@H](c3ccc(Cl)c(Cl)c3)C2)cc(OC)c1O |
| InChI | InChI=1S/C19H21Cl2NO4/c1-24-16-7-12(8-17(25-2)19(16)23)10-22-5-6-26-18(11-22)13-3-4-14(20)15(21)9-13/h3-4,7-9,18,23H,5-6,10-11H2,1-2H3/t18-/m1/s1 |
| InChIKey | BPFWVVATSBVYLN-GOSISDBHSA-N |
| XLogP | 4.29 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |