C17H17Cl2NO4 — CID 56919206
2-[[2-(3,4-dichlorophenyl)morpholin-4-yl]methyl]-5-methoxypyran-4-one (PubChem CID 56919206) has the molecular formula C17H17Cl2NO4 and a molecular weight of 370.23 g/mol. Its IUPAC name is 2-[[2-(3,4-dichlorophenyl)morpholin-4-yl]methyl]-5-methoxypyran-4-one.
| Compound Name | 2-[[2-(3,4-dichlorophenyl)morpholin-4-yl]methyl]-5-methoxypyran-4-one |
|---|---|
| PubChem CID | 56919206 |
| Molecular Formula | C17H17Cl2NO4 |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 2-[[2-(3,4-dichlorophenyl)morpholin-4-yl]methyl]-5-methoxypyran-4-one |
| SMILES | COc1coc(CN2CCOC(c3ccc(Cl)c(Cl)c3)C2)cc1=O |
| InChI | InChI=1S/C17H17Cl2NO4/c1-22-17-10-24-12(7-15(17)21)8-20-4-5-23-16(9-20)11-2-3-13(18)14(19)6-11/h2-3,6-7,10,16H,4-5,8-9H2,1H3 |
| InChIKey | BJUKAGXBBUKACQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |