C19H21Cl2NO3 — CID 95402420
2-[2-[[(2R)-2-(3,4-dichlorophenyl)morpholin-4-yl]methyl]phenoxy]ethanol (PubChem CID 95402420) has the molecular formula C19H21Cl2NO3 and a molecular weight of 382.29 g/mol. Its IUPAC name is 2-[2-[[(2R)-2-(3,4-dichlorophenyl)morpholin-4-yl]methyl]phenoxy]ethanol.
| Compound Name | 2-[2-[[(2R)-2-(3,4-dichlorophenyl)morpholin-4-yl]methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 95402420 |
| Molecular Formula | C19H21Cl2NO3 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2-[2-[[(2R)-2-(3,4-dichlorophenyl)morpholin-4-yl]methyl]phenoxy]ethanol |
| SMILES | OCCOc1ccccc1CN1CCO[C@H](c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C19H21Cl2NO3/c20-16-6-5-14(11-17(16)21)19-13-22(7-9-24-19)12-15-3-1-2-4-18(15)25-10-8-23/h1-6,11,19,23H,7-10,12-13H2/t19-/m0/s1 |
| InChIKey | WPIMYJVVBYRYSS-IBGZPJMESA-N |
| XLogP | 3.94 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |