C19H22FNO3 — CID 74237175
4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-2-phenylmorpholine (PubChem CID 74237175) has the molecular formula C19H22FNO3 and a molecular weight of 331.39 g/mol. Its IUPAC name is 4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-2-phenylmorpholine.
| Compound Name | 4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-2-phenylmorpholine |
|---|---|
| PubChem CID | 74237175 |
| Molecular Formula | C19H22FNO3 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-2-phenylmorpholine |
| SMILES | COc1cc(F)c(CN2CCOC(c3ccccc3)C2)cc1OC |
| InChI | InChI=1S/C19H22FNO3/c1-22-17-10-15(16(20)11-18(17)23-2)12-21-8-9-24-19(13-21)14-6-4-3-5-7-14/h3-7,10-11,19H,8-9,12-13H2,1-2H3 |
| InChIKey | LMDWZTUNLHXBBB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |