C26H29NO4 — CID 67352745
(2R)-4-[(2,4-dimethoxyphenyl)methyl]-2-(4-phenylmethoxyphenyl)morpholine (PubChem CID 67352745) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is (2R)-4-[(2,4-dimethoxyphenyl)methyl]-2-(4-phenylmethoxyphenyl)morpholine.
| Compound Name | (2R)-4-[(2,4-dimethoxyphenyl)methyl]-2-(4-phenylmethoxyphenyl)morpholine |
|---|---|
| PubChem CID | 67352745 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | (2R)-4-[(2,4-dimethoxyphenyl)methyl]-2-(4-phenylmethoxyphenyl)morpholine |
| SMILES | COc1ccc(CN2CCO[C@H](c3ccc(OCc4ccccc4)cc3)C2)c(OC)c1 |
| InChI | InChI=1S/C26H29NO4/c1-28-24-13-10-22(25(16-24)29-2)17-27-14-15-30-26(18-27)21-8-11-23(12-9-21)31-19-20-6-4-3-5-7-20/h3-13,16,26H,14-15,17-19H2,1-2H3/t26-/m0/s1 |
| InChIKey | KJBGSFJQSBBMRJ-SANMLTNESA-N |
| XLogP | 4.86 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |