C29H35N3O2 — CID 156519943
(4aS,7aR)-1,4-dibenzyl-6-[(2,4-dimethoxyphenyl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b]pyrazine (PubChem CID 156519943) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is (4aS,7aR)-1,4-dibenzyl-6-[(2,4-dimethoxyphenyl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b]pyrazine.
| Compound Name | (4aS,7aR)-1,4-dibenzyl-6-[(2,4-dimethoxyphenyl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b]pyrazine |
|---|---|
| PubChem CID | 156519943 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | (4aS,7aR)-1,4-dibenzyl-6-[(2,4-dimethoxyphenyl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b]pyrazine |
| SMILES | COc1ccc(CN2C[C@@H]3[C@H](C2)N(Cc2ccccc2)CCN3Cc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C29H35N3O2/c1-33-26-14-13-25(29(17-26)34-2)20-30-21-27-28(22-30)32(19-24-11-7-4-8-12-24)16-15-31(27)18-23-9-5-3-6-10-23/h3-14,17,27-28H,15-16,18-22H2,1-2H3/t27-,28+ |
| InChIKey | YIHZHVXSEFFXEW-HNRBIFIRSA-N |
| XLogP | 4.27 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |