C20H25BrN2O2 — CID 1222780
1-[(4-bromophenyl)methyl]-4-[(2,4-dimethoxyphenyl)methyl]piperazine (PubChem CID 1222780) has the molecular formula C20H25BrN2O2 and a molecular weight of 405.34 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-4-[(2,4-dimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(4-bromophenyl)methyl]-4-[(2,4-dimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 1222780 |
| Molecular Formula | C20H25BrN2O2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-4-[(2,4-dimethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(CN2CCN(Cc3ccc(Br)cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C20H25BrN2O2/c1-24-19-8-5-17(20(13-19)25-2)15-23-11-9-22(10-12-23)14-16-3-6-18(21)7-4-16/h3-8,13H,9-12,14-15H2,1-2H3 |
| InChIKey | UWGWOIWDQKYYMG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |