C36H40Br4N4 — CID 71732809
1,4,7,10-tetrakis[(4-bromophenyl)methyl]-1,4,7,10-tetrazacyclododecane (PubChem CID 71732809) has the molecular formula C36H40Br4N4 and a molecular weight of 848.36 g/mol. Its IUPAC name is 1,4,7,10-tetrakis[(4-bromophenyl)methyl]-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1,4,7,10-tetrakis[(4-bromophenyl)methyl]-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 71732809 |
| Molecular Formula | C36H40Br4N4 |
| Molecular Weight | 848.36 g/mol |
| Exact Mass | 844.00 |
| IUPAC Name | 1,4,7,10-tetrakis[(4-bromophenyl)methyl]-1,4,7,10-tetrazacyclododecane |
| SMILES | Brc1ccc(CN2CCN(Cc3ccc(Br)cc3)CCN(Cc3ccc(Br)cc3)CCN(Cc3ccc(Br)cc3)CC2)cc1 |
| InChI | InChI=1S/C36H40Br4N4/c37-33-9-1-29(2-10-33)25-41-17-19-42(26-30-3-11-34(38)12-4-30)21-23-44(28-32-7-15-36(40)16-8-32)24-22-43(20-18-41)27-31-5-13-35(39)14-6-31/h1-16H,17-28H2 |
| InChIKey | XKKJSSWOIMQNDG-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.36 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |